C19H30N2O5 — CID 167677819
(2S,3S,4S)-3,4-dimethyl-1-oxido-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium;(2R,3R,4R)-2-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 167677819) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is (2S,3S,4S)-3,4-dimethyl-1-oxido-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium;(2R,3R,4R)-2-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4S)-3,4-dimethyl-1-oxido-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium;(2R,3R,4R)-2-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 167677819 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (2S,3S,4S)-3,4-dimethyl-1-oxido-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium;(2R,3R,4R)-2-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | C[C@H]1[C@H](C)C=[N+]([O-])[C@@H]1COCc1ccccc1.OC[C@H]1NC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO2.C5H11NO3/c1-11-8-15(16)14(12(11)2)10-17-9-13-6-4-3-5-7-13;7-2-3-5(9)4(8)1-6-3/h3-8,11-12,14H,9-10H2,1-2H3;3-9H,1-2H2/t11-,12+,14-;3-,4-,5-/m11/s1 |
| InChIKey | VBQHROYOSVQBPV-QGFQWKHSSA-N |
| XLogP | 0.11 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|