C15H23NO2 — CID 58451425
(1S,2R,3S,4S,5S)-2-amino-3,4-dimethyl-5-(phenylmethoxymethyl)cyclopentan-1-ol (PubChem CID 58451425) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (1S,2R,3S,4S,5S)-2-amino-3,4-dimethyl-5-(phenylmethoxymethyl)cyclopentan-1-ol.
| Compound Name | (1S,2R,3S,4S,5S)-2-amino-3,4-dimethyl-5-(phenylmethoxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 58451425 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (1S,2R,3S,4S,5S)-2-amino-3,4-dimethyl-5-(phenylmethoxymethyl)cyclopentan-1-ol |
| SMILES | C[C@H]1[C@H](C)[C@@H](COCc2ccccc2)[C@H](O)[C@@H]1N |
| InChI | InChI=1S/C15H23NO2/c1-10-11(2)14(16)15(17)13(10)9-18-8-12-6-4-3-5-7-12/h3-7,10-11,13-15,17H,8-9,16H2,1-2H3/t10-,11-,13+,14+,15-/m0/s1 |
| InChIKey | RXBBQDVKVMRRDS-ADNNSEGNSA-N |
| XLogP | 1.79 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |