C34H35NO5 — CID 15344365
(2R,3R,4S,5S)-1-oxido-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 15344365) has the molecular formula C34H35NO5 and a molecular weight of 537.66 g/mol. Its IUPAC name is (2R,3R,4S,5S)-1-oxido-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | (2R,3R,4S,5S)-1-oxido-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 15344365 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | (2R,3R,4S,5S)-1-oxido-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | [O-][N+]1=C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C34H35NO5/c36-35-21-32(38-23-28-15-7-2-8-16-28)34(40-25-30-19-11-4-12-20-30)33(39-24-29-17-9-3-10-18-29)31(35)26-37-22-27-13-5-1-6-14-27/h1-21,31-34H,22-26H2/t31-,32+,33-,34-/m1/s1 |
| InChIKey | VRDRLLPCCODUKY-KMKAFXEASA-N |
| XLogP | 5.92 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|