C15H18F3NO5 — CID 176815952
2,2,2-trifluoro-N-[(3S,4R,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-phenylmethoxyoxan-3-yl]acetamide (PubChem CID 176815952) has the molecular formula C15H18F3NO5 and a molecular weight of 349.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S,4R,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-phenylmethoxyoxan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3S,4R,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-phenylmethoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 176815952 |
| Molecular Formula | C15H18F3NO5 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S,4R,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-phenylmethoxyoxan-3-yl]acetamide |
| SMILES | O=C(N[C@H]1CO[C@H](CO)[C@H](O)[C@@H]1OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO5/c16-15(17,18)14(22)19-10-8-23-11(6-20)12(21)13(10)24-7-9-4-2-1-3-5-9/h1-5,10-13,20-21H,6-8H2,(H,19,22)/t10-,11+,12-,13+/m0/s1 |
| InChIKey | DQHATSQEODAOGH-QNWHQSFQSA-N |
| XLogP | 0.37 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |