C15H18F3NO6 — CID 125035200
N-[(2R,3R,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 125035200) has the molecular formula C15H18F3NO6 and a molecular weight of 365.30 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R,3R,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 125035200 |
| Molecular Formula | C15H18F3NO6 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[(2R,3R,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@H]1[C@H](OCc2ccccc2)O[C@@H](CO)[C@H](O)[C@H]1O)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO6/c16-15(17,18)14(23)19-10-12(22)11(21)9(6-20)25-13(10)24-7-8-4-2-1-3-5-8/h1-5,9-13,20-22H,6-7H2,(H,19,23)/t9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | ODWVAEKVYDDEDH-FPYNETTCSA-N |
| XLogP | -0.31 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |