C15H18Cl3NO6 — CID 11058769
2,2,2-trichloro-N-[(2S,3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]acetamide (PubChem CID 11058769) has the molecular formula C15H18Cl3NO6 and a molecular weight of 414.67 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2S,3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(2S,3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 11058769 |
| Molecular Formula | C15H18Cl3NO6 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 2,2,2-trichloro-N-[(2S,3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]acetamide |
| SMILES | O=C(N[C@@H]1[C@@H](OCc2ccccc2)O[C@H](CO)[C@H](O)[C@@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H18Cl3NO6/c16-15(17,18)14(23)19-10-12(22)11(21)9(6-20)25-13(10)24-7-8-4-2-1-3-5-8/h1-5,9-13,20-22H,6-7H2,(H,19,23)/t9-,10+,11+,12-,13+/m1/s1 |
| InChIKey | CTUULHHKXBRMHF-SJHCENCUSA-N |
| XLogP | 0.50 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|