C23H26F3NO4 — CID 174153791
2,2,2-trifluoro-N-[(3S,4S,5R,6S)-5-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 174153791) has the molecular formula C23H26F3NO4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S,4S,5R,6S)-5-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3S,4S,5R,6S)-5-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 174153791 |
| Molecular Formula | C23H26F3NO4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S,4S,5R,6S)-5-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC1[C@@H](COCc2ccccc2)OC[C@H](NC(=O)C(F)(F)F)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H26F3NO4/c1-16-20(15-29-12-17-8-4-2-5-9-17)30-14-19(27-22(28)23(24,25)26)21(16)31-13-18-10-6-3-7-11-18/h2-11,16,19-21H,12-15H2,1H3,(H,27,28)/t16?,19-,20+,21-/m0/s1 |
| InChIKey | YIJDKSHZIDDPSL-DTHFOOOUSA-N |
| XLogP | 3.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |