C28H34F3NO7 — CID 167569149
5-[(2R,4R,5R)-4-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxypentanoic acid (PubChem CID 167569149) has the molecular formula C28H34F3NO7 and a molecular weight of 553.57 g/mol. Its IUPAC name is 5-[(2R,4R,5R)-4-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxypentanoic acid.
| Compound Name | 5-[(2R,4R,5R)-4-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 167569149 |
| Molecular Formula | C28H34F3NO7 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 5-[(2R,4R,5R)-4-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxypentanoic acid |
| SMILES | C[C@@H]1C(NC(=O)C(F)(F)F)[C@H](OCCCCC(=O)O)OC(COCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H34F3NO7/c1-19-24(32-27(35)28(29,30)31)26(37-15-9-8-14-23(33)34)39-22(18-36-16-20-10-4-2-5-11-20)25(19)38-17-21-12-6-3-7-13-21/h2-7,10-13,19,22,24-26H,8-9,14-18H2,1H3,(H,32,35)(H,33,34)/t19-,22?,24?,25-,26-/m1/s1 |
| InChIKey | PUROCSFMLGCFCB-GVATVRQOSA-N |
| XLogP | 4.47 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|