C42H42O6 — CID 23241381
(1R,2S,3S,4R,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-7-oxabicyclo[4.1.0]heptane (PubChem CID 23241381) has the molecular formula C42H42O6 and a molecular weight of 642.79 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (1R,2S,3S,4R,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 23241381 |
| Molecular Formula | C42H42O6 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | (1R,2S,3S,4R,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-7-oxabicyclo[4.1.0]heptane |
| SMILES | c1ccc(COC[C@@]2(OCc3ccccc3)[C@@H]3O[C@@H]3[C@H](OCc3ccccc3)C(OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C42H42O6/c1-6-16-32(17-7-1)26-43-31-42(47-30-36-24-14-5-15-25-36)40(46-29-35-22-12-4-13-23-35)38(45-28-34-20-10-3-11-21-34)37(39-41(42)48-39)44-27-33-18-8-2-9-19-33/h1-25,37-41H,26-31H2/t37-,38?,39-,40+,41-,42+/m1/s1 |
| InChIKey | PDYIFLJBGBLMFU-GZTXUAIVSA-N |
| XLogP | 7.70 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|