C34H34O8S — CID 10555593
(3aS,4S,5R,6R,6aR)-4,5,6-tris(phenylmethoxy)-3a-(phenylmethoxymethyl)-4,5,6,6a-tetrahydrocyclopenta[d][1,3,2]dioxathiole 2,2-dioxide (PubChem CID 10555593) has the molecular formula C34H34O8S and a molecular weight of 602.71 g/mol. Its IUPAC name is (3aS,4S,5R,6R,6aR)-4,5,6-tris(phenylmethoxy)-3a-(phenylmethoxymethyl)-4,5,6,6a-tetrahydrocyclopenta[d][1,3,2]dioxathiole 2,2-dioxide.
| Compound Name | (3aS,4S,5R,6R,6aR)-4,5,6-tris(phenylmethoxy)-3a-(phenylmethoxymethyl)-4,5,6,6a-tetrahydrocyclopenta[d][1,3,2]dioxathiole 2,2-dioxide |
|---|---|
| PubChem CID | 10555593 |
| Molecular Formula | C34H34O8S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | (3aS,4S,5R,6R,6aR)-4,5,6-tris(phenylmethoxy)-3a-(phenylmethoxymethyl)-4,5,6,6a-tetrahydrocyclopenta[d][1,3,2]dioxathiole 2,2-dioxide |
| SMILES | O=S1(=O)O[C@@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@]2(COCc2ccccc2)O1 |
| InChI | InChI=1S/C34H34O8S/c35-43(36)41-33-31(39-23-28-17-9-3-10-18-28)30(38-22-27-15-7-2-8-16-27)32(40-24-29-19-11-4-12-20-29)34(33,42-43)25-37-21-26-13-5-1-6-14-26/h1-20,30-33H,21-25H2/t30-,31-,32+,33-,34+/m1/s1 |
| InChIKey | KLKLSFMAJSBFCE-RUOAZZEASA-N |
| XLogP | 5.37 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |