C29H34O4S — CID 139851965
(3S,4R,5S,6R)-6-ethyl-6-methyl-3,4,5-tris(phenylmethoxy)oxane-2-thiol (PubChem CID 139851965) has the molecular formula C29H34O4S and a molecular weight of 478.65 g/mol. Its IUPAC name is (3S,4R,5S,6R)-6-ethyl-6-methyl-3,4,5-tris(phenylmethoxy)oxane-2-thiol.
| Compound Name | (3S,4R,5S,6R)-6-ethyl-6-methyl-3,4,5-tris(phenylmethoxy)oxane-2-thiol |
|---|---|
| PubChem CID | 139851965 |
| Molecular Formula | C29H34O4S |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (3S,4R,5S,6R)-6-ethyl-6-methyl-3,4,5-tris(phenylmethoxy)oxane-2-thiol |
| SMILES | CC[C@@]1(C)OC(S)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H34O4S/c1-3-29(2)27(32-21-24-17-11-6-12-18-24)25(30-19-22-13-7-4-8-14-22)26(28(34)33-29)31-20-23-15-9-5-10-16-23/h4-18,25-28,34H,3,19-21H2,1-2H3/t25-,26-,27-,28?,29+/m0/s1 |
| InChIKey | IJCDCLKBWIYTDM-ASQSUWINSA-N |
| XLogP | 6.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|