C29H33ClO6 — CID 70396461
[(2R,3R,4S,5R,6S)-6-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl hypochlorite (PubChem CID 70396461) has the molecular formula C29H33ClO6 and a molecular weight of 513.03 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl hypochlorite.
| Compound Name | [(2R,3R,4S,5R,6S)-6-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl hypochlorite |
|---|---|
| PubChem CID | 70396461 |
| Molecular Formula | C29H33ClO6 |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl hypochlorite |
| SMILES | CO[C@@]1(C)O[C@H](COCl)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H33ClO6/c1-29(31-2)28(34-20-24-16-10-5-11-17-24)27(33-19-23-14-8-4-9-15-23)26(25(36-29)21-35-30)32-18-22-12-6-3-7-13-22/h3-17,25-28H,18-21H2,1-2H3/t25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | JACVQGDQMXTCRC-RQKPWJHBSA-N |
| XLogP | 5.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |