C33H43BrO5Si — CID 173333738
[(2R,3R,4S,5R,6R)-2-bromo-6-[(2-methylpropan-2-yl)oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]-dimethylsilane (PubChem CID 173333738) has the molecular formula C33H43BrO5Si and a molecular weight of 627.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-bromo-6-[(2-methylpropan-2-yl)oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]-dimethylsilane.
| Compound Name | [(2R,3R,4S,5R,6R)-2-bromo-6-[(2-methylpropan-2-yl)oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 173333738 |
| Molecular Formula | C33H43BrO5Si |
| Molecular Weight | 627.69 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-bromo-6-[(2-methylpropan-2-yl)oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]-dimethylsilane |
| SMILES | C[SiH](C)[C@]1(Br)O[C@H](COC(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H43BrO5Si/c1-32(2,3)38-24-28-29(35-21-25-15-9-6-10-16-25)30(36-22-26-17-11-7-12-18-26)31(33(34,39-28)40(4)5)37-23-27-19-13-8-14-20-27/h6-20,28-31,40H,21-24H2,1-5H3/t28-,29-,30+,31-,33-/m1/s1 |
| InChIKey | ALKDXGUIVQEVQX-FCLIIASSSA-N |
| XLogP | 7.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|