C22H36O5Si — CID 170851237
dimethyl-[(2S,3R,5S,6R)-6-[(2-methylpropan-2-yl)oxymethyl]-5-phenylmethoxy-3-prop-2-enoxyoxan-2-yl]oxysilane (PubChem CID 170851237) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is dimethyl-[(2S,3R,5S,6R)-6-[(2-methylpropan-2-yl)oxymethyl]-5-phenylmethoxy-3-prop-2-enoxyoxan-2-yl]oxysilane.
| Compound Name | dimethyl-[(2S,3R,5S,6R)-6-[(2-methylpropan-2-yl)oxymethyl]-5-phenylmethoxy-3-prop-2-enoxyoxan-2-yl]oxysilane |
|---|---|
| PubChem CID | 170851237 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | dimethyl-[(2S,3R,5S,6R)-6-[(2-methylpropan-2-yl)oxymethyl]-5-phenylmethoxy-3-prop-2-enoxyoxan-2-yl]oxysilane |
| SMILES | C=CCO[C@@H]1C[C@H](OCc2ccccc2)[C@@H](COC(C)(C)C)O[C@H]1O[SiH](C)C |
| InChI | InChI=1S/C22H36O5Si/c1-7-13-23-19-14-18(24-15-17-11-9-8-10-12-17)20(16-25-22(2,3)4)26-21(19)27-28(5)6/h7-12,18-21,28H,1,13-16H2,2-6H3/t18-,19+,20+,21-/m0/s1 |
| InChIKey | CCTKOBZUTMZNKB-BQJUDKOJSA-N |
| XLogP | 4.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|