C29H32O7 — CID 15484325
(1S,4R,5S,6R,7R,8R)-5,7-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,9-dioxabicyclo[4.2.1]nonane-4,8-diol (PubChem CID 15484325) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is (1S,4R,5S,6R,7R,8R)-5,7-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,9-dioxabicyclo[4.2.1]nonane-4,8-diol.
| Compound Name | (1S,4R,5S,6R,7R,8R)-5,7-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,9-dioxabicyclo[4.2.1]nonane-4,8-diol |
|---|---|
| PubChem CID | 15484325 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (1S,4R,5S,6R,7R,8R)-5,7-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,9-dioxabicyclo[4.2.1]nonane-4,8-diol |
| SMILES | O[C@H]1[C@H]2OC[C@@H](O)[C@H](OCc3ccccc3)[C@@](COCc3ccccc3)(O2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H32O7/c30-24-19-35-28-25(31)27(34-18-23-14-8-3-9-15-23)29(36-28,20-32-16-21-10-4-1-5-11-21)26(24)33-17-22-12-6-2-7-13-22/h1-15,24-28,30-31H,16-20H2/t24-,25-,26+,27-,28+,29-/m1/s1 |
| InChIKey | SRGKOUYLOKUKEC-WINAUWCFSA-N |
| XLogP | 3.22 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |