C29H32O5 — CID 163488560
(1S,2R,3R,4R,5S)-4-methyl-2,3-bis(phenylmethoxy)-1-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 163488560) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-4-methyl-2,3-bis(phenylmethoxy)-1-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1S,2R,3R,4R,5S)-4-methyl-2,3-bis(phenylmethoxy)-1-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 163488560 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (1S,2R,3R,4R,5S)-4-methyl-2,3-bis(phenylmethoxy)-1-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | C[C@H]1[C@H]2OC[C@](COCc3ccccc3)(O2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H32O5/c1-22-26(31-18-24-13-7-3-8-14-24)27(32-19-25-15-9-4-10-16-25)29(21-33-28(22)34-29)20-30-17-23-11-5-2-6-12-23/h2-16,22,26-28H,17-21H2,1H3/t22-,26-,27-,28+,29+/m1/s1 |
| InChIKey | CKQGSVWYPBPRIU-CERLBWDESA-N |
| XLogP | 5.14 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |