C46H56FNO8 — CID 58123175
tert-butyl N-[(E,2S,3R)-3-fluoro-1-[(2R,3R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]carbamate (PubChem CID 58123175) has the molecular formula C46H56FNO8 and a molecular weight of 769.95 g/mol. Its IUPAC name is tert-butyl N-[(E,2S,3R)-3-fluoro-1-[(2R,3R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S,3R)-3-fluoro-1-[(2R,3R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58123175 |
| Molecular Formula | C46H56FNO8 |
| Molecular Weight | 769.95 g/mol |
| Exact Mass | 769.40 |
| IUPAC Name | tert-butyl N-[(E,2S,3R)-3-fluoro-1-[(2R,3R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]carbamate |
| SMILES | CC/C=C/[C@@H](F)[C@H](CO[C@@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H]1OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C46H56FNO8/c1-5-6-27-38(47)39(48-45(49)56-46(2,3)4)32-54-44-43(53-31-37-25-17-10-18-26-37)42(52-30-36-23-15-9-16-24-36)41(51-29-35-21-13-8-14-22-35)40(55-44)33-50-28-34-19-11-7-12-20-34/h6-27,38-44H,5,28-33H2,1-4H3,(H,48,49)/b27-6+/t38-,39+,40?,41+,42?,43-,44-/m1/s1 |
| InChIKey | KETNROQDDPMAMC-DAXIRMJWSA-N |
| XLogP | 8.90 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.95 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|