C34H45NO8SSi — CID 56926662
[(1S)-1-[(4S,5R)-5-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(phenylmethoxycarbonylamino)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] methanesulfonate (PubChem CID 56926662) has the molecular formula C34H45NO8SSi and a molecular weight of 655.89 g/mol. Its IUPAC name is [(1S)-1-[(4S,5R)-5-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(phenylmethoxycarbonylamino)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] methanesulfonate.
| Compound Name | [(1S)-1-[(4S,5R)-5-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(phenylmethoxycarbonylamino)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 56926662 |
| Molecular Formula | C34H45NO8SSi |
| Molecular Weight | 655.89 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | [(1S)-1-[(4S,5R)-5-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(phenylmethoxycarbonylamino)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] methanesulfonate |
| SMILES | C[C@H](OS(C)(=O)=O)[C@H]1OC(C)(C)O[C@@H]1[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H45NO8SSi/c1-25(43-44(7,37)38)30-31(42-34(5,6)41-30)29(35-32(36)39-23-26-17-11-8-12-18-26)24-40-45(33(2,3)4,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-22,25,29-31H,23-24H2,1-7H3,(H,35,36)/t25-,29-,30+,31+/m0/s1 |
| InChIKey | OEQMBSZINAVCEJ-HNEFVXLSSA-N |
| XLogP | 4.74 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|