C33H43NO5Si — CID 135021247
benzyl N-[(4S,5R)-4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (PubChem CID 135021247) has the molecular formula C33H43NO5Si and a molecular weight of 561.80 g/mol. Its IUPAC name is benzyl N-[(4S,5R)-4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate.
| Compound Name | benzyl N-[(4S,5R)-4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 135021247 |
| Molecular Formula | C33H43NO5Si |
| Molecular Weight | 561.80 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | benzyl N-[(4S,5R)-4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| SMILES | CC1(C)OC[C@@H](NC(=O)OCc2ccccc2)[C@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C33H43NO5Si/c1-32(2,3)40(27-18-11-7-12-19-27,28-20-13-8-14-21-28)38-23-15-22-30-29(25-37-33(4,5)39-30)34-31(35)36-24-26-16-9-6-10-17-26/h6-14,16-21,29-30H,15,22-25H2,1-5H3,(H,34,35)/t29-,30+/m1/s1 |
| InChIKey | PALHJKMGTJJTIF-IHLOFXLRSA-N |
| XLogP | 5.79 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|