C29H37NO3Si — CID 15419395
benzyl N-[1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]carbamate (PubChem CID 15419395) has the molecular formula C29H37NO3Si and a molecular weight of 475.71 g/mol. Its IUPAC name is benzyl N-[1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 15419395 |
| Molecular Formula | C29H37NO3Si |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | benzyl N-[1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H37NO3Si/c1-23(2)27(30-28(31)32-21-24-15-9-6-10-16-24)22-33-34(29(3,4)5,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,27H,21-22H2,1-5H3,(H,30,31) |
| InChIKey | FGGJITJGLIZELZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|