C19H27NO11S2 — CID 102581005
[(2R)-2-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-(phenylmethoxycarbonylamino)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] methanesulfonate (PubChem CID 102581005) has the molecular formula C19H27NO11S2 and a molecular weight of 509.56 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-(phenylmethoxycarbonylamino)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] methanesulfonate.
| Compound Name | [(2R)-2-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-(phenylmethoxycarbonylamino)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 102581005 |
| Molecular Formula | C19H27NO11S2 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | [(2R)-2-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-(phenylmethoxycarbonylamino)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] methanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](COS(C)(=O)=O)OS(C)(=O)=O)[C@H](NC(=O)OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H27NO11S2/c1-19(2)29-16-14(20-18(21)26-10-12-8-6-5-7-9-12)15(28-17(16)30-19)13(31-33(4,24)25)11-27-32(3,22)23/h5-9,13-17H,10-11H2,1-4H3,(H,20,21)/t13-,14+,15-,16-,17-/m1/s1 |
| InChIKey | DUXNVQLHRPHPSN-ZHCJQAHYSA-N |
| XLogP | 0.48 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|