C24H29NO7 — CID 134970665
benzyl N-[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]carbamate (PubChem CID 134970665) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is benzyl N-[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]carbamate.
| Compound Name | benzyl N-[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 134970665 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | benzyl N-[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]carbamate |
| SMILES | CC1(C)O[C@H]2O[C@H](C(CO)NC(=O)OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C24H29NO7/c1-24(2)31-21-20(28-14-16-9-5-3-6-10-16)19(30-22(21)32-24)18(13-26)25-23(27)29-15-17-11-7-4-8-12-17/h3-12,18-22,26H,13-15H2,1-2H3,(H,25,27)/t18?,19-,20+,21-,22-/m1/s1 |
| InChIKey | IMQNBLGHROBGGS-RFQIGKHKSA-N |
| XLogP | 2.74 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |