C37H50N2O7 — CID 6477644
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(8E)-2-oxo-16-phenyl-1-oxa-3-azacyclohexadec-8-en-3-yl]-1-phenylbutan-2-yl]carbamate (PubChem CID 6477644) has the molecular formula C37H50N2O7 and a molecular weight of 634.81 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(8E)-2-oxo-16-phenyl-1-oxa-3-azacyclohexadec-8-en-3-yl]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(8E)-2-oxo-16-phenyl-1-oxa-3-azacyclohexadec-8-en-3-yl]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 6477644 |
| Molecular Formula | C37H50N2O7 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.36 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(8E)-2-oxo-16-phenyl-1-oxa-3-azacyclohexadec-8-en-3-yl]-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CN1CCCC/C=C/CCCCCCC(c2ccccc2)OC1=O)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C37H50N2O7/c40-32(31(25-28-17-11-9-12-18-28)38-36(41)45-34-27-44-35-30(34)22-24-43-35)26-39-23-16-8-6-4-2-1-3-5-7-15-21-33(46-37(39)42)29-19-13-10-14-20-29/h2,4,9-14,17-20,30-35,40H,1,3,5-8,15-16,21-27H2,(H,38,41)/b4-2+/t30-,31-,32+,33?,34-,35+/m0/s1 |
| InChIKey | PUNIEWFKHFDVJS-AFFYTEDASA-N |
| XLogP | 6.71 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|