C17H24N2O5 — CID 69315949
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3S)-4-amino-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 69315949) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3S)-4-amino-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3S)-4-amino-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 69315949 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3S)-4-amino-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | NC[C@H](O)[C@H](Cc1ccccc1)NC(=O)OC1COC2OCCC12 |
| InChI | InChI=1S/C17H24N2O5/c18-9-14(20)13(8-11-4-2-1-3-5-11)19-17(21)24-15-10-23-16-12(15)6-7-22-16/h1-5,12-16,20H,6-10,18H2,(H,19,21)/t12?,13-,14-,15?,16?/m0/s1 |
| InChIKey | TZOGRIFIHKVBEC-BAQAQHDRSA-N |
| XLogP | 0.40 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |