C26H40N2O7 — CID 58612412
tert-butyl N-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)carbamate (PubChem CID 58612412) has the molecular formula C26H40N2O7 and a molecular weight of 492.61 g/mol. Its IUPAC name is tert-butyl N-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 58612412 |
| Molecular Formula | C26H40N2O7 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | tert-butyl N-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40N2O7/c1-17(2)14-28(25(31)35-26(3,4)5)15-21(29)20(13-18-9-7-6-8-10-18)27-24(30)34-22-16-33-23-19(22)11-12-32-23/h6-10,17,19-23,29H,11-16H2,1-5H3,(H,27,30) |
| InChIKey | WHAVBTKASWWFIJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |