C32H44N4O8 — CID 59305747
methyl N-[1-[2-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 59305747) has the molecular formula C32H44N4O8 and a molecular weight of 612.72 g/mol. Its IUPAC name is methyl N-[1-[2-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[1-[2-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59305747 |
| Molecular Formula | C32H44N4O8 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | methyl N-[1-[2-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)NN(Cc1ccccc1)CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)C(C)(C)C |
| InChI | InChI=1S/C32H44N4O8/c1-32(2,3)27(34-30(39)41-4)28(38)35-36(18-22-13-9-6-10-14-22)19-25(37)24(17-21-11-7-5-8-12-21)33-31(40)44-26-20-43-29-23(26)15-16-42-29/h5-14,23-27,29,37H,15-20H2,1-4H3,(H,33,40)(H,34,39)(H,35,38) |
| InChIKey | SXZDYIUEVDYXLZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 147.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|