C37H47N5O7 — CID 59305707
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(2-acetamido-3,3-dimethylbutanoyl)amino]-[(4-pyridin-2-ylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59305707) has the molecular formula C37H47N5O7 and a molecular weight of 673.81 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(2-acetamido-3,3-dimethylbutanoyl)amino]-[(4-pyridin-2-ylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(2-acetamido-3,3-dimethylbutanoyl)amino]-[(4-pyridin-2-ylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59305707 |
| Molecular Formula | C37H47N5O7 |
| Molecular Weight | 673.81 g/mol |
| Exact Mass | 673.35 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(2-acetamido-3,3-dimethylbutanoyl)amino]-[(4-pyridin-2-ylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(=O)NC(C(=O)NN(Cc1ccc(-c2ccccn2)cc1)CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)C(C)(C)C |
| InChI | InChI=1S/C37H47N5O7/c1-24(43)39-33(37(2,3)4)34(45)41-42(21-26-13-15-27(16-14-26)29-12-8-9-18-38-29)22-31(44)30(20-25-10-6-5-7-11-25)40-36(46)49-32-23-48-35-28(32)17-19-47-35/h5-16,18,28,30-33,35,44H,17,19-23H2,1-4H3,(H,39,43)(H,40,46)(H,41,45) |
| InChIKey | GTENFRWHBIDLFV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 151.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|