C35H41N5O8 — CID 25033340
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(5,5-dimethyl-2-oxo-1,3-oxazolidine-4-carbonyl)amino]-[(4-pyridin-2-ylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 25033340) has the molecular formula C35H41N5O8 and a molecular weight of 659.74 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(5,5-dimethyl-2-oxo-1,3-oxazolidine-4-carbonyl)amino]-[(4-pyridin-2-ylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(5,5-dimethyl-2-oxo-1,3-oxazolidine-4-carbonyl)amino]-[(4-pyridin-2-ylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 25033340 |
| Molecular Formula | C35H41N5O8 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(5,5-dimethyl-2-oxo-1,3-oxazolidine-4-carbonyl)amino]-[(4-pyridin-2-ylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC1(C)OC(=O)NC1C(=O)NN(Cc1ccc(-c2ccccn2)cc1)CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12 |
| InChI | InChI=1S/C35H41N5O8/c1-35(2)30(38-34(44)48-35)31(42)39-40(19-23-11-13-24(14-12-23)26-10-6-7-16-36-26)20-28(41)27(18-22-8-4-3-5-9-22)37-33(43)47-29-21-46-32-25(29)15-17-45-32/h3-14,16,25,27-30,32,41H,15,17-21H2,1-2H3,(H,37,43)(H,38,44)(H,39,42) |
| InChIKey | MZRXSPRMGKPGEU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|