C29H33IN4O5 — CID 118983588
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3S)-3-hydroxy-4-[(iodoamino)-[(4-pyridin-2-ylphenyl)methyl]amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 118983588) has the molecular formula C29H33IN4O5 and a molecular weight of 644.51 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3S)-3-hydroxy-4-[(iodoamino)-[(4-pyridin-2-ylphenyl)methyl]amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3S)-3-hydroxy-4-[(iodoamino)-[(4-pyridin-2-ylphenyl)methyl]amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 118983588 |
| Molecular Formula | C29H33IN4O5 |
| Molecular Weight | 644.51 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3S)-3-hydroxy-4-[(iodoamino)-[(4-pyridin-2-ylphenyl)methyl]amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc1ccc(-c2ccccn2)cc1)NI)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C29H33IN4O5/c30-33-34(17-21-9-11-22(12-10-21)24-8-4-5-14-31-24)18-26(35)25(16-20-6-2-1-3-7-20)32-29(36)39-27-19-38-28-23(27)13-15-37-28/h1-12,14,23,25-28,33,35H,13,15-19H2,(H,32,36)/t23-,25-,26-,27-,28+/m0/s1 |
| InChIKey | XQLIPRFZNWNXLL-FWWXEKRMSA-N |
| XLogP | 3.87 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|