C22H32N2O6 — CID 21356327
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-(cyclopentyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 21356327) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-(cyclopentyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-(cyclopentyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 21356327 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-(cyclopentyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CNOC1CCCC1)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C22H32N2O6/c25-19(13-23-30-16-8-4-5-9-16)18(12-15-6-2-1-3-7-15)24-22(26)29-20-14-28-21-17(20)10-11-27-21/h1-3,6-7,16-21,23,25H,4-5,8-14H2,(H,24,26)/t17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | QQTSYMIQPRJFQF-JRSUCEMESA-N |
| XLogP | 1.91 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|