C17H26N2O4 — CID 87741183
[(2S,3S)-4-(cyclohexyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 87741183) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is [(2S,3S)-4-(cyclohexyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3S)-4-(cyclohexyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87741183 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [(2S,3S)-4-(cyclohexyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)[C@@H](O)CNOC1CCCCC1 |
| InChI | InChI=1S/C17H26N2O4/c20-16(12-18-23-14-9-5-2-6-10-14)15(19-17(21)22)11-13-7-3-1-4-8-13/h1,3-4,7-8,14-16,18-20H,2,5-6,9-12H2,(H,21,22)/t15-,16-/m0/s1 |
| InChIKey | ZROCMDGAEXDECC-HOTGVXAUSA-N |
| XLogP | 2.08 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|