C23H30N2O7S — CID 87740746
[(2S,3R)-4-[cyclohexyloxy-(4-hydroxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 87740746) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is [(2S,3R)-4-[cyclohexyloxy-(4-hydroxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-4-[cyclohexyloxy-(4-hydroxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87740746 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [(2S,3R)-4-[cyclohexyloxy-(4-hydroxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)[C@H](O)CN(OC1CCCCC1)S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H30N2O7S/c26-18-11-13-20(14-12-18)33(30,31)25(32-19-9-5-2-6-10-19)16-22(27)21(24-23(28)29)15-17-7-3-1-4-8-17/h1,3-4,7-8,11-14,19,21-22,24,26-27H,2,5-6,9-10,15-16H2,(H,28,29)/t21-,22+/m0/s1 |
| InChIKey | XJNVENRBBHHSAB-FCHUYYIVSA-N |
| XLogP | 2.89 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|