C29H37N3O10S — CID 59090738
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S)-4-[cyclohexyloxy-(4-nitrophenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59090738) has the molecular formula C29H37N3O10S and a molecular weight of 619.69 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S)-4-[cyclohexyloxy-(4-nitrophenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S)-4-[cyclohexyloxy-(4-nitrophenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59090738 |
| Molecular Formula | C29H37N3O10S |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S)-4-[cyclohexyloxy-(4-nitrophenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(O)CN(OC1CCCCC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)OC1COC2OCCC12 |
| InChI | InChI=1S/C29H37N3O10S/c33-26(18-31(42-22-9-5-2-6-10-22)43(37,38)23-13-11-21(12-14-23)32(35)36)25(17-20-7-3-1-4-8-20)30-29(34)41-27-19-40-28-24(27)15-16-39-28/h1,3-4,7-8,11-14,22,24-28,33H,2,5-6,9-10,15-19H2,(H,30,34)/t24?,25-,26?,27?,28?/m0/s1 |
| InChIKey | ODHWRPXFBGYRDT-KLNXQMOFSA-N |
| XLogP | 3.31 |
| TPSA | 166.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|