C29H37N3O9S — CID 89242127
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(3R)-4-[(3-carbamoylphenyl)sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 89242127) has the molecular formula C29H37N3O9S and a molecular weight of 603.69 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(3R)-4-[(3-carbamoylphenyl)sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(3R)-4-[(3-carbamoylphenyl)sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 89242127 |
| Molecular Formula | C29H37N3O9S |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(3R)-4-[(3-carbamoylphenyl)sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | NC(=O)c1cccc(S(=O)(=O)N(C[C@@H](O)C(Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)OC2CCCC2)c1 |
| InChI | InChI=1S/C29H37N3O9S/c30-27(34)20-9-6-12-22(16-20)42(36,37)32(41-21-10-4-5-11-21)17-25(33)24(15-19-7-2-1-3-8-19)31-29(35)40-26-18-39-28-23(26)13-14-38-28/h1-3,6-9,12,16,21,23-26,28,33H,4-5,10-11,13-15,17-18H2,(H2,30,34)(H,31,35)/t23-,24?,25+,26-,28+/m0/s1 |
| InChIKey | DBXQHFMVUXLOQM-YGPGOVGWSA-N |
| XLogP | 2.11 |
| TPSA | 166.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|