C28H36N2O10S — CID 58683439
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(3-hydroxyphenyl)sulfonyl-(oxan-4-yloxy)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 58683439) has the molecular formula C28H36N2O10S and a molecular weight of 592.67 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(3-hydroxyphenyl)sulfonyl-(oxan-4-yloxy)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(3-hydroxyphenyl)sulfonyl-(oxan-4-yloxy)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58683439 |
| Molecular Formula | C28H36N2O10S |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(3-hydroxyphenyl)sulfonyl-(oxan-4-yloxy)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CN(OC1CCOCC1)S(=O)(=O)c1cccc(O)c1)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C28H36N2O10S/c31-20-7-4-8-22(16-20)41(34,35)30(40-21-9-12-36-13-10-21)17-25(32)24(15-19-5-2-1-3-6-19)29-28(33)39-26-18-38-27-23(26)11-14-37-27/h1-8,16,21,23-27,31-32H,9-15,17-18H2,(H,29,33)/t23-,24-,25+,26-,27+/m0/s1 |
| InChIKey | YGVFXEJJRKJWLR-UIPNDDLNSA-N |
| XLogP | 1.95 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|