C24H32N4O7S — CID 57264410
[(2S,3R)-4-[[3-[(2-amino-2-oxoethyl)amino]phenyl]sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 57264410) has the molecular formula C24H32N4O7S and a molecular weight of 520.61 g/mol. Its IUPAC name is [(2S,3R)-4-[[3-[(2-amino-2-oxoethyl)amino]phenyl]sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-4-[[3-[(2-amino-2-oxoethyl)amino]phenyl]sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 57264410 |
| Molecular Formula | C24H32N4O7S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [(2S,3R)-4-[[3-[(2-amino-2-oxoethyl)amino]phenyl]sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | NC(=O)CNc1cccc(S(=O)(=O)N(C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O)OC2CCCC2)c1 |
| InChI | InChI=1S/C24H32N4O7S/c25-23(30)15-26-18-9-6-12-20(14-18)36(33,34)28(35-19-10-4-5-11-19)16-22(29)21(27-24(31)32)13-17-7-2-1-3-8-17/h1-3,6-9,12,14,19,21-22,26-27,29H,4-5,10-11,13,15-16H2,(H2,25,30)(H,31,32)/t21-,22+/m0/s1 |
| InChIKey | WTWSCVVMGYREAJ-FCHUYYIVSA-N |
| XLogP | 1.69 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|