C20H30N2O5 — CID 22997110
oxolan-3-yl N-[4-(cyclopentyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 22997110) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is oxolan-3-yl N-[4-(cyclopentyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | oxolan-3-yl N-[4-(cyclopentyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 22997110 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | oxolan-3-yl N-[4-(cyclopentyloxyamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1)C(O)CNOC1CCCC1)OC1CCOC1 |
| InChI | InChI=1S/C20H30N2O5/c23-19(13-21-27-16-8-4-5-9-16)18(12-15-6-2-1-3-7-15)22-20(24)26-17-10-11-25-14-17/h1-3,6-7,16-19,21,23H,4-5,8-14H2,(H,22,24) |
| InChIKey | NRRLLYIMTBYOKP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|