C30H41N3O7S — CID 22868221
[(3S)-oxolan-3-yl] N-[(3S)-4-[3-acetamido-6-(cyclohexylmethyl)-2-sulfamoylphenyl]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 22868221) has the molecular formula C30H41N3O7S and a molecular weight of 587.74 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[(3S)-4-[3-acetamido-6-(cyclohexylmethyl)-2-sulfamoylphenyl]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3S)-oxolan-3-yl] N-[(3S)-4-[3-acetamido-6-(cyclohexylmethyl)-2-sulfamoylphenyl]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 22868221 |
| Molecular Formula | C30H41N3O7S |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[(3S)-4-[3-acetamido-6-(cyclohexylmethyl)-2-sulfamoylphenyl]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(=O)Nc1ccc(CC2CCCCC2)c(C[C@H](O)C(Cc2ccccc2)NC(=O)O[C@H]2CCOC2)c1S(N)(=O)=O |
| InChI | InChI=1S/C30H41N3O7S/c1-20(34)32-26-13-12-23(16-21-8-4-2-5-9-21)25(29(26)41(31,37)38)18-28(35)27(17-22-10-6-3-7-11-22)33-30(36)40-24-14-15-39-19-24/h3,6-7,10-13,21,24,27-28,35H,2,4-5,8-9,14-19H2,1H3,(H,32,34)(H,33,36)(H2,31,37,38)/t24-,27?,28-/m0/s1 |
| InChIKey | DMMRRYONTFFESG-VVENGHIQSA-N |
| XLogP | 3.44 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |