C27H35N3O7S — CID 20978840
oxolan-3-yl N-[4-[(4-acetamidophenyl)sulfonyl-(2-methylprop-2-enyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 20978840) has the molecular formula C27H35N3O7S and a molecular weight of 545.66 g/mol. Its IUPAC name is oxolan-3-yl N-[4-[(4-acetamidophenyl)sulfonyl-(2-methylprop-2-enyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | oxolan-3-yl N-[4-[(4-acetamidophenyl)sulfonyl-(2-methylprop-2-enyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 20978840 |
| Molecular Formula | C27H35N3O7S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | oxolan-3-yl N-[4-[(4-acetamidophenyl)sulfonyl-(2-methylprop-2-enyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | C=C(C)CN(CC(O)C(Cc1ccccc1)NC(=O)OC1CCOC1)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C27H35N3O7S/c1-19(2)16-30(38(34,35)24-11-9-22(10-12-24)28-20(3)31)17-26(32)25(15-21-7-5-4-6-8-21)29-27(33)37-23-13-14-36-18-23/h4-12,23,25-26,32H,1,13-18H2,2-3H3,(H,28,31)(H,29,33) |
| InChIKey | WXRZKQBJTMDTEP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|