C36H46N2O8 — CID 91537443
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(oxan-4-yloxyamino)-1-phenylbutan-2-yl]carbamate;1-methyl-3-phenylmethoxybenzene (PubChem CID 91537443) has the molecular formula C36H46N2O8 and a molecular weight of 634.77 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(oxan-4-yloxyamino)-1-phenylbutan-2-yl]carbamate;1-methyl-3-phenylmethoxybenzene.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(oxan-4-yloxyamino)-1-phenylbutan-2-yl]carbamate;1-methyl-3-phenylmethoxybenzene |
|---|---|
| PubChem CID | 91537443 |
| Molecular Formula | C36H46N2O8 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(oxan-4-yloxyamino)-1-phenylbutan-2-yl]carbamate;1-methyl-3-phenylmethoxybenzene |
| SMILES | Cc1cccc(OCc2ccccc2)c1.O=C(N[C@@H](Cc1ccccc1)[C@H](O)CNOC1CCOCC1)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C22H32N2O7.C14H14O/c25-19(13-23-31-16-6-9-27-10-7-16)18(12-15-4-2-1-3-5-15)24-22(26)30-20-14-29-21-17(20)8-11-28-21;1-12-6-5-9-14(10-12)15-11-13-7-3-2-4-8-13/h1-5,16-21,23,25H,6-14H2,(H,24,26);2-10H,11H2,1H3/t17-,18-,19+,20-,21+;/m0./s1 |
| InChIKey | JDALGHJWUXVSMZ-VDUHGPFJSA-N |
| XLogP | 4.72 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|