C25H30N2O6 — CID 59815828
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(phenacylamino)-1-phenylbutan-2-yl]carbamate (PubChem CID 59815828) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(phenacylamino)-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(phenacylamino)-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59815828 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(phenacylamino)-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CNCC(=O)c1ccccc1)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C25H30N2O6/c28-21(18-9-5-2-6-10-18)14-26-15-22(29)20(13-17-7-3-1-4-8-17)27-25(30)33-23-16-32-24-19(23)11-12-31-24/h1-10,19-20,22-24,26,29H,11-16H2,(H,27,30)/t19-,20-,22+,23-,24+/m0/s1 |
| InChIKey | VGEXNDPDKQAEOT-KHFRZORUSA-N |
| XLogP | 1.92 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |