C32H53N2O8P — CID 89111718
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(Z)-6-dibutoxyphosphoryl-2-methylhex-2-enyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 89111718) has the molecular formula C32H53N2O8P and a molecular weight of 624.76 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(Z)-6-dibutoxyphosphoryl-2-methylhex-2-enyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(Z)-6-dibutoxyphosphoryl-2-methylhex-2-enyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 89111718 |
| Molecular Formula | C32H53N2O8P |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(Z)-6-dibutoxyphosphoryl-2-methylhex-2-enyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCCOP(=O)(CCC/C=C(/C)CNCC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)OCCCC |
| InChI | InChI=1S/C32H53N2O8P/c1-4-6-17-40-43(37,41-18-7-5-2)20-12-11-13-25(3)22-33-23-29(35)28(21-26-14-9-8-10-15-26)34-32(36)42-30-24-39-31-27(30)16-19-38-31/h8-10,13-15,27-31,33,35H,4-7,11-12,16-24H2,1-3H3,(H,34,36)/b25-13- |
| InChIKey | BISZHHAZPHEGHR-MXAYSNPKSA-N |
| XLogP | 5.59 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|