C21H32N2O6 — CID 59131370
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-1-(4-hydroxyphenyl)-4-(2-methylpropylamino)butan-2-yl]carbamate (PubChem CID 59131370) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-1-(4-hydroxyphenyl)-4-(2-methylpropylamino)butan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-1-(4-hydroxyphenyl)-4-(2-methylpropylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59131370 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-1-(4-hydroxyphenyl)-4-(2-methylpropylamino)butan-2-yl]carbamate |
| SMILES | CC(C)CNC[C@@H](O)[C@H](Cc1ccc(O)cc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C21H32N2O6/c1-13(2)10-22-11-18(25)17(9-14-3-5-15(24)6-4-14)23-21(26)29-19-12-28-20-16(19)7-8-27-20/h3-6,13,16-20,22,24-25H,7-12H2,1-2H3,(H,23,26)/t16-,17-,18+,19-,20+/m0/s1 |
| InChIKey | QHEKDADQCHZHNZ-UHZRXMQZSA-N |
| XLogP | 1.40 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |