C24H30N2O7 — CID 59132330
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(3,4-dihydroxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59132330) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(3,4-dihydroxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(3,4-dihydroxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59132330 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(3,4-dihydroxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1)C(O)CNCc1ccc(O)c(O)c1)OC1COC2OCCC12 |
| InChI | InChI=1S/C24H30N2O7/c27-19-7-6-16(11-20(19)28)12-25-13-21(29)18(10-15-4-2-1-3-5-15)26-24(30)33-22-14-32-23-17(22)8-9-31-23/h1-7,11,17-18,21-23,25,27-29H,8-10,12-14H2,(H,26,30) |
| InChIKey | SAIXLVABBUTXKX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|