C29H35N3O6 — CID 15956084
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(2-oxospiro[1H-indole-3,2'-piperidine]-1'-yl)-1-phenylbutan-2-yl]carbamate (PubChem CID 15956084) has the molecular formula C29H35N3O6 and a molecular weight of 521.61 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(2-oxospiro[1H-indole-3,2'-piperidine]-1'-yl)-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(2-oxospiro[1H-indole-3,2'-piperidine]-1'-yl)-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 15956084 |
| Molecular Formula | C29H35N3O6 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-(2-oxospiro[1H-indole-3,2'-piperidine]-1'-yl)-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CN1CCCCC12C(=O)Nc1ccccc12)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C29H35N3O6/c33-24(17-32-14-7-6-13-29(32)21-10-4-5-11-22(21)30-27(29)34)23(16-19-8-2-1-3-9-19)31-28(35)38-25-18-37-26-20(25)12-15-36-26/h1-5,8-11,20,23-26,33H,6-7,12-18H2,(H,30,34)(H,31,35)/t20-,23-,24+,25-,26+,29?/m0/s1 |
| InChIKey | NJQZGKXPQSYAMD-DZQIDBRZSA-N |
| XLogP | 2.78 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |