C27H41NO4Si — CID 138968584
tert-butyl N-[(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-4-methylpentan-2-yl]carbamate (PubChem CID 138968584) has the molecular formula C27H41NO4Si and a molecular weight of 471.71 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 138968584 |
| Molecular Formula | C27H41NO4Si |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | tert-butyl N-[(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-4-methylpentan-2-yl]carbamate |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H41NO4Si/c1-21(18-22(19-29)28-25(30)32-26(2,3)4)20-31-33(27(5,6)7,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,21-22,29H,18-20H2,1-7H3,(H,28,30)/t21-,22+/m1/s1 |
| InChIKey | VDIZGPVXZDIIFN-YADHBBJMSA-N |
| XLogP | 4.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|