C26H39NO5Si — CID 162415524
tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxypentan-2-yl]carbamate (PubChem CID 162415524) has the molecular formula C26H39NO5Si and a molecular weight of 473.69 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 162415524 |
| Molecular Formula | C26H39NO5Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxypentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](O)CO |
| InChI | InChI=1S/C26H39NO5Si/c1-25(2,3)32-24(30)27-20(17-21(29)18-28)19-31-33(26(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,20-21,28-29H,17-19H2,1-6H3,(H,27,30)/t20-,21+/m0/s1 |
| InChIKey | GGXHCJHQBGNNQV-LEWJYISDSA-N |
| XLogP | 3.20 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|