C23H30F3NO4Si — CID 123983134
N-[1-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxypentan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 123983134) has the molecular formula C23H30F3NO4Si and a molecular weight of 469.58 g/mol. Its IUPAC name is N-[1-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxypentan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxypentan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 123983134 |
| Molecular Formula | C23H30F3NO4Si |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-[1-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxypentan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(O)C(O)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H30F3NO4Si/c1-16(28)20(29)19(27-21(30)23(24,25)26)15-31-32(22(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19-20,28-29H,15H2,1-4H3,(H,27,30) |
| InChIKey | NWXHCCQNAVYARY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|