C30H46N2O6Si — CID 135018668
tert-butyl N-[1-[(4R,5S)-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethylamino]carbamate (PubChem CID 135018668) has the molecular formula C30H46N2O6Si and a molecular weight of 558.79 g/mol. Its IUPAC name is tert-butyl N-[1-[(4R,5S)-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethylamino]carbamate.
| Compound Name | tert-butyl N-[1-[(4R,5S)-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethylamino]carbamate |
|---|---|
| PubChem CID | 135018668 |
| Molecular Formula | C30H46N2O6Si |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | tert-butyl N-[1-[(4R,5S)-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethylamino]carbamate |
| SMILES | CC(NNC(=O)OC(C)(C)C)[C@H]1OC(C)(C)O[C@H]1[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H46N2O6Si/c1-21(31-32-27(34)38-28(2,3)4)25-26(37-30(8,9)36-25)24(33)20-35-39(29(5,6)7,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-19,21,24-26,31,33H,20H2,1-9H3,(H,32,34)/t21?,24-,25-,26+/m1/s1 |
| InChIKey | PSENVXGCTBRKPF-NBMFSXFYSA-N |
| XLogP | 3.86 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|