C26H34N4O5Si — CID 56926660
(3aR,4S,8S,8aR)-4-(azidomethyl)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-e][1,3]oxazepin-6-one (PubChem CID 56926660) has the molecular formula C26H34N4O5Si and a molecular weight of 510.67 g/mol. Its IUPAC name is (3aR,4S,8S,8aR)-4-(azidomethyl)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-e][1,3]oxazepin-6-one.
| Compound Name | (3aR,4S,8S,8aR)-4-(azidomethyl)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-e][1,3]oxazepin-6-one |
|---|---|
| PubChem CID | 56926660 |
| Molecular Formula | C26H34N4O5Si |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (3aR,4S,8S,8aR)-4-(azidomethyl)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-e][1,3]oxazepin-6-one |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@H](CN=[N+]=[N-])OC(=O)N[C@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34N4O5Si/c1-25(2,3)36(18-12-8-6-9-13-18,19-14-10-7-11-15-19)32-17-20-22-23(35-26(4,5)34-22)21(16-28-30-27)33-24(31)29-20/h6-15,20-23H,16-17H2,1-5H3,(H,29,31)/t20-,21-,22+,23+/m0/s1 |
| InChIKey | JNHPDSAQRPUYPR-MYDTUXCISA-N |
| XLogP | 3.87 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|